3-Phenoxybenzoic acid structure
|
Common Name | 3-Phenoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 3739-38-6 | Molecular Weight | 214.217 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 372.9±25.0 °C at 760 mmHg | |
| Molecular Formula | C13H10O3 | Melting Point | 147-149 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 145.7±16.7 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of 3-Phenoxybenzoic acid3-Phenoxybenzoic acid is an endogenous metabolite. |
| Name | 3-phenoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 3-Phenoxybenzoic acid is an endogenous metabolite. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 372.9±25.0 °C at 760 mmHg |
| Melting Point | 147-149 °C(lit.) |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.217 |
| Flash Point | 145.7±16.7 °C |
| Exact Mass | 214.062988 |
| PSA | 46.53000 |
| LogP | 3.91 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | NXTDJHZGHOFSQG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(Oc2ccccc2)c1 |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H400 |
| Precautionary Statements | P273-P280-P304 + P340 + P312-P305 + P351 + P338-P337 + P313-P391 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | DH6293500 |
| HS Code | 29189090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Perturbation of rat heart plasma membrane fluidity due to metabolites of permethrin insecticide.
Cardiovasc. Toxicol. 11(3) , 226-34, (2011) Due to increased global use, acute and chronic exposures to pyrethroid insecticides in humans are of clinical concern. Pyrethroids have a primary mode of action that involves interference with the sod... |
|
|
Degradation of 3-phenoxybenzoic acid by a Bacillus sp.
PLoS ONE 7(11) , e50456, (2012) 3-Phenoxybenzoic acid (3-PBA) is of great environmental concern with regards to endocrine disrupting activity and widespread occurrence in water and soil, yet little is known about microbial degradati... |
|
|
The central role of mosquito cytochrome P450 CYP6Zs in insecticide detoxification revealed by functional expression and structural modelling.
Biochem. J. 455(1) , 75-85, (2013) The resistance of mosquitoes to chemical insecticides is threatening vector control programmes worldwide. Cytochrome P450 monooxygenases (CYPs) are known to play a major role in insecticide resistance... |
| m-phenoxybenzoic acid |
| 3-Carboxydiphenyl ether |
| EINECS 223-121-2 |
| m-phenoxybenzaldehyde |
| 3-Phenoxybenzoic acid |
| Benzoic acid,3-phenoxy |
| R41207 |
| Benzoic acid, 3-phenoxy- |
| BENZOIC ACID,m-PHENOXY |
| C 16045200 3-Phenoxybenzo |
| meta-phenoxybenzoic acid |
| 3-PhOC6H4COOH |
| MFCD00002498 |