MG-262 structure
|
Common Name | MG-262 | ||
|---|---|---|---|---|
| CAS Number | 179324-22-2 | Molecular Weight | 491.42800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H42BN3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MG-262MG-262 is a reversible proteasome inhibitor with diverse biological activities[1][2][3]. |
| Name | [(1R)-3-methyl-1-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]pentanoyl]amino]butyl]boronic acid |
|---|---|
| Synonym | More Synonyms |
| Description | MG-262 is a reversible proteasome inhibitor with diverse biological activities[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H42BN3O6 |
|---|---|
| Molecular Weight | 491.42800 |
| Exact Mass | 491.31700 |
| PSA | 147.46000 |
| LogP | 4.70620 |
| InChIKey | MWKOOGAFELWOCD-FKBYEOEOSA-N |
| SMILES | CC(C)CC(NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)OCc1ccccc1)B(O)O |
| Storage condition | -20°C |
| mg-262 |
| unii-549v4dp94w |
| a8179 |
| ps-iii |