Rufinamide structure
|
Common Name | Rufinamide | ||
|---|---|---|---|---|
| CAS Number | 1795037-48-7 | Molecular Weight | 240.205849956 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6D2F2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RufinamideRufinamide-15N,d2 is the deuterium and 15N labeled Rufinamide[1]. Rufinamide is a new antiepileptic agent that differs structurally from other antiepileptic drugs and is approved as adjunctive therapy for Lennox-Gastaut syndrome (LGS)[2][3]. |
| Name | 1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-carboxamide |
|---|
| Description | Rufinamide-15N,d2 is the deuterium and 15N labeled Rufinamide[1]. Rufinamide is a new antiepileptic agent that differs structurally from other antiepileptic drugs and is approved as adjunctive therapy for Lennox-Gastaut syndrome (LGS)[2][3]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C10H6D2F2N4O |
|---|---|
| Molecular Weight | 240.205849956 |
| InChIKey | POGQSBRIGCQNEG-RPVANBMVSA-N |
| SMILES | NC(=O)c1cn(Cc2c(F)cccc2F)nn1 |