2-(Perfluorobutyl)ethyl methacrylate structure
|
Common Name | 2-(Perfluorobutyl)ethyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 1799-84-4 | Molecular Weight | 332.16300 | |
| Density | 1.402 | Boiling Point | 60 °C | |
| Molecular Formula | C10H9F9O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 79 °C | |
| Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.402 |
|---|---|
| Boiling Point | 60 °C |
| Molecular Formula | C10H9F9O2 |
| Molecular Weight | 332.16300 |
| Flash Point | 79 °C |
| Exact Mass | 332.04600 |
| PSA | 26.30000 |
| LogP | 3.96400 |
| Vapour Pressure | 0.681mmHg at 25°C |
| Index of Refraction | 1.353 |
| InChIKey | TYNRPOFACABVSI-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Storage condition | Keep Cold |
| Hazard Codes | F: Flammable;Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2916140000 |
|
~%
2-(Perfluorobut... CAS#:1799-84-4 |
| Literature: US2009/23948 A1, ; Page/Page column 5 ; |
|
~80%
2-(Perfluorobut... CAS#:1799-84-4 |
| Literature: Krupers, Maarten J.; Moeller, Martin Journal of Fluorine Chemistry, 1997 , vol. 82, # 2 p. 119 - 124 |
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| 1H,1H,2H,2H-Perfluorohexyl methacrylate |
| PC5906E |
| EINECS 217-287-5 |
| Methacrylic Acid 1H,1H,2H,2H-Nonafluorohexyl Ester |
| Methacrylic Acid 3,3,4,4,5,5,6,6,6-Nonafluorohexyl Ester |
| MFCD00236094 |
| 3,3,4,4,5,5,6,6,6-Nonafluorohexyl methacrylate |
| 2-(Perfluorobutyl)ethyl methacrylate |