Boc-PEG5-methyl ester structure
|
Common Name | Boc-PEG5-methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1807530-04-6 | Molecular Weight | 408.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H36O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Boc-PEG5-methyl esterBoc-PEG5-methyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Boc-PEG5-methyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-PEG5-methyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C19H36O9 |
|---|---|
| Molecular Weight | 408.48 |
| InChIKey | BJNQNORQYFJOCD-UHFFFAOYSA-N |
| SMILES | COC(=O)CCOCCOCCOCCOCCOCCC(=O)OC(C)(C)C |
| MFCD28015779 |