Boc-L-Tyrosine methyl ester structure
|
Common Name | Boc-L-Tyrosine methyl ester | ||
|---|---|---|---|---|
| CAS Number | 4326-36-7 | Molecular Weight | 295.331 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 452.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO5 | Melting Point | 100-104 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 227.6±27.3 °C | |
Use of Boc-L-Tyrosine methyl esterBoc-L-Tyrosine methyl ester is a tyrosine derivative[1]. |
| Name | methyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-L-Tyrosine methyl ester is a tyrosine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 452.7±40.0 °C at 760 mmHg |
| Melting Point | 100-104 °C(lit.) |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.331 |
| Flash Point | 227.6±27.3 °C |
| Exact Mass | 295.141968 |
| PSA | 84.86000 |
| LogP | 2.65 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | NQIFXJSLCUJHBB-LBPRGKRZSA-N |
| SMILES | COC(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
A Supramolecular Gel Approach to Minimize the Neural Cell Damage during Cryopreservation Process.
Macromol. Biosci. 16 , 363-70, (2016) The storage method for living cells is one of the major challenges in cell-based applications. Here, a novel supramolecular gel cryopreservation system (BDTC gel system) is introduced, which can obser... |
| Methyl N-(tert-butoxycarbonyl)-L-tyrosinate |
| MFCD00191181 |
| N-Boc-L-tyrosine Methyl Ester |
| N-t-butyloxycarbonyl-S-tyrosine methyl ester |
| N-(tert-Butoxycarbonyl)-L-tyrosine Methyl Ester |
| Boc-Tyr-Ome |
| Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-, methyl ester |
| Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate |
| Boc-L-Tyrosinemethylester |
| Boc-L-Tyrosine Methyl Ester |
| Boc-L-tyrosine methylester |