(benzenesulfonyl-dichloro-methyl)sulfonylbenzene structure
|
Common Name | (benzenesulfonyl-dichloro-methyl)sulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 18087-00-8 | Molecular Weight | 365.25200 | |
| Density | 1.52g/cm3 | Boiling Point | 527.8ºC at 760 mmHg | |
| Molecular Formula | C13H10Cl2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273ºC | |
| Name | [benzenesulfonyl(dichloro)methyl]sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 527.8ºC at 760 mmHg |
| Molecular Formula | C13H10Cl2O4S2 |
| Molecular Weight | 365.25200 |
| Flash Point | 273ºC |
| Exact Mass | 363.94000 |
| PSA | 85.04000 |
| LogP | 5.18470 |
| Vapour Pressure | 1.06E-10mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | KWTYNXBXYJPAEY-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)C(Cl)(Cl)S(=O)(=O)c1ccccc1 |
|
~55%
(benzenesulfony... CAS#:18087-00-8 |
| Literature: Hadjiarapoglou, Lazaros; Spyroudis, Spyros; Varvoglis, Anastasios Journal of the American Chemical Society, 1985 , vol. 107, # 24 p. 7178 - 7179 |
|
~%
(benzenesulfony... CAS#:18087-00-8 |
| Literature: Hadjiarapoglou, Lazaros; Spyroudis, Spyros; Varvoglis, Anastasios Journal of the American Chemical Society, 1985 , vol. 107, # 24 p. 7178 - 7179 |
|
~%
(benzenesulfony... CAS#:18087-00-8 |
| Literature: Jarvis,B.B.; Fried,H.E. Journal of Organic Chemistry, 1975 , vol. 40, # 9 p. 1278 - 1280 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,1'-[(dichloromethanediyl)disulfonyl]dibenzene |
| Bis-(phenylsulfonyl)-dichlormethan |
| Bis-(benzolsulfonyl)-dichlormethan |
| bis(phenylsulfonyl)dichloromethane |
| Dichlorbis(phenylsulfonyl)methan |