Benzene,1,1'-[(bromomethylene)bis(sulfonyl)]bis- (9CI) structure
|
Common Name | Benzene,1,1'-[(bromomethylene)bis(sulfonyl)]bis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 18087-04-2 | Molecular Weight | 375.25800 | |
| Density | 1.624g/cm3 | Boiling Point | 553.7ºC at 760 mmHg | |
| Molecular Formula | C13H11BrO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.7ºC | |
| Name | [benzenesulfonyl(bromo)methyl]sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.624g/cm3 |
|---|---|
| Boiling Point | 553.7ºC at 760 mmHg |
| Molecular Formula | C13H11BrO4S2 |
| Molecular Weight | 375.25800 |
| Flash Point | 288.7ºC |
| Exact Mass | 373.92800 |
| PSA | 85.04000 |
| LogP | 4.77430 |
| Vapour Pressure | 9.77E-12mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | JQZULCGDVVRTEA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)C(Br)S(=O)(=O)c1ccccc1 |
|
~%
Benzene,1,1'-[(... CAS#:18087-04-2 |
| Literature: Kohler, Tishler Journal of the American Chemical Society, 1935 , vol. 57, p. 217,222 |
|
~%
Benzene,1,1'-[(... CAS#:18087-04-2 |
| Literature: Kohler, Tishler Journal of the American Chemical Society, 1935 , vol. 57, p. 217,222 |
|
~%
Benzene,1,1'-[(... CAS#:18087-04-2 |
| Literature: Kohler, Tishler Journal of the American Chemical Society, 1935 , vol. 57, p. 217,222 |
|
~%
Benzene,1,1'-[(... CAS#:18087-04-2 |
| Literature: Kohler, Tishler Journal of the American Chemical Society, 1935 , vol. 57, p. 217,222 |
| Bis-benzolsulfonyl-brom-methan |
| Brom-diphenylsulfon-methan |
| 1,1'-[(bromomethanediyl)disulfonyl]dibenzene |
| bis-benzenesulfonyl-bromo-methane |
| Diphenylsulfon-methylbromid |