2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane
2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane structure
|
Common Name | 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane | ||
|---|---|---|---|---|
| CAS Number | 61368-83-0 | Molecular Weight | 508.54600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H21O5PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H21O5PS2 |
|---|---|
| Molecular Weight | 508.54600 |
| Exact Mass | 508.05700 |
| PSA | 107.86000 |
| LogP | 6.95920 |
| InChIKey | WUFUEPGZEIXFSW-UHFFFAOYSA-N |
| SMILES | O=S(=O)(C(=COP(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~74%
2,2-bis(benzene... CAS#:61368-83-0 |
| Literature: Kolodyazhnyi, O. I. J. Gen. Chem. USSR (Engl. Transl.), 1982 , vol. 52, # 7 p. 1538 - 1543,1358 - 1363 |
|
~76%
2,2-bis(benzene... CAS#:61368-83-0 |
| Literature: Kolodiazhnyi, Oleg I. Tetrahedron Letters, 1982 , vol. 23, # 5 p. 499 - 502 |
|
~%
2,2-bis(benzene... CAS#:61368-83-0 |
| Literature: Kolodyazhnyi,O.I.; Kukhar',V.P. Zhurnal Organicheskoi Khimii, 1977 , vol. 13, # 2 p. 275 - 282,248 - 254 |
|
~%
2,2-bis(benzene... CAS#:61368-83-0 |
| Literature: Kolodyazhnyi,O.I.; Kukhar',V.P. Zhurnal Organicheskoi Khimii, 1977 , vol. 13, # 2 p. 275 - 282,248 - 254 |
|
~%
2,2-bis(benzene... CAS#:61368-83-0 |
| Literature: Kolodyazhnyi,O.I.; Kukhar',V.P. Zhurnal Organicheskoi Khimii, 1977 , vol. 13, # 2 p. 275 - 282,248 - 254 |
|
~%
2,2-bis(benzene... CAS#:61368-83-0 |
| Literature: Kolodiazhnyi, Oleg I. Tetrahedron Letters, 1982 , vol. 23, # 5 p. 499 - 502 |
|
~%
2,2-bis(benzene... CAS#:61368-83-0 |
| Literature: Kolodiazhnyi, Oleg I. Tetrahedron Letters, 1982 , vol. 23, # 5 p. 499 - 502 |
|
~%
2,2-bis(benzene... CAS#:61368-83-0 |
| Literature: Kolodiazhnyi, Oleg I. Tetrahedron Letters, 1982 , vol. 23, # 5 p. 499 - 502 |
|
~%
2,2-bis(benzene... CAS#:61368-83-0 |
| Literature: Kolodiazhnyi, Oleg I. Tetrahedron Letters, 1982 , vol. 23, # 5 p. 499 - 502 |
![[bis(benzenesulfonyl)methyl-phenylphosphoryl]benzene structure](https://image.chemsrc.com/caspic/437/61368-82-9.png)
![Benzene,1,1'-[(bromomethylene)bis(sulfonyl)]bis- (9CI) structure](https://image.chemsrc.com/caspic/402/18087-04-2.png)
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 61368-83-0? |
| A: Chinese name of 61368-83-0 is 61368-83-0. |
| Q: What is the LogP of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane? |
| A: LogP of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane is 6.95920. |
| Q: What is the SMILES notation of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane? |
| A: SMILES notation of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane is O=S(=O)(C(=COP(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1. |
| Q: What is the CAS number of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane? |
| A: CAS number of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane is 61368-83-0. |
| Q: What is the English name of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane? |
| A: The English name of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane is 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane. |
| Q: What is the InChIKey of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane? |
| A: InChIKey of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane is WUFUEPGZEIXFSW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane? |
| A: Molecular weight of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane is 508.54600. |
| Q: What is the molecular formula of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane? |
| A: Molecular formula of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane is C26H21O5PS2. |
| Q: What is the polar surface area (PSA) of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane? |
| A: Polar surface area (PSA) of 2,2-bis(benzenesulfonyl)ethenoxy-diphenylphosphane is 107.86000. |