LDL-IN-3
Modify Date: 2025-08-26 17:29:50
LDL-IN-3 structure
|
Common Name | LDL-IN-3 | ||
|---|---|---|---|---|
| CAS Number | 180908-67-2 | Molecular Weight | 400.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H36O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LDL-IN-3LDL-IN-3 is an anti-atherosclerotic compound extracted from patent WO/2005/039596A1, example C25 and patent US 6133467, example 3. |
| Name | LDL-IN-3 |
|---|
| Description | LDL-IN-3 is an anti-atherosclerotic compound extracted from patent WO/2005/039596A1, example C25 and patent US 6133467, example 3. |
|---|---|
| Related Catalog | |
| In Vitro | LDL-IN-3 is antioxidant which inhibits low density lipoprotein (LDL) lipid peroxidation and is useful as anti-atherosclerotic agents[1][2]. |
| In Vivo | LDL-IN-3 decreases serum cholesterol, TBARS and the amount of aortic lesions (57 %) in comparison with control rabbits. LDL-IN-3 is found in very high concentrations in the serum (182.4 μg/mL) and livers (323 μg/mL)[1][2]. |
| References |
[1]. WO/2005/039596A1 [2]. US 6133467 |
| Molecular Formula | C24H36O3Si |
|---|---|
| Molecular Weight | 400.63 |
| InChIKey | PJKUTMONJXDZNR-UHFFFAOYSA-N |
| SMILES | COc1ccc([Si](C)(C)COc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |