4-methoxy-2-nitrobenzenesulfonyl chloride structure
|
Common Name | 4-methoxy-2-nitrobenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 18092-54-1 | Molecular Weight | 251.64400 | |
| Density | 1.553g/cm3 | Boiling Point | 416.2ºC at 760mmHg | |
| Molecular Formula | C7H6ClNO5S | Melting Point | 78ºC | |
| MSDS | USA | Flash Point | 205.5ºC | |
| Name | 4-methoxy-2-nitrobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.553g/cm3 |
|---|---|
| Boiling Point | 416.2ºC at 760mmHg |
| Melting Point | 78ºC |
| Molecular Formula | C7H6ClNO5S |
| Molecular Weight | 251.64400 |
| Flash Point | 205.5ºC |
| Exact Mass | 250.96600 |
| PSA | 97.57000 |
| LogP | 3.13490 |
| Vapour Pressure | 3.91mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | OGHAPVZVXLHURO-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)Cl)c([N+](=O)[O-])c1 |
| Storage condition | 2-8°C |
| Hazard Codes | C |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3261 |
| HS Code | 2909309090 |
|
~%
4-methoxy-2-nit... CAS#:18092-54-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 48, # 23 p. 7363 - 7373 |
|
~%
4-methoxy-2-nit... CAS#:18092-54-1 |
| Literature: Gazzetta Chimica Italiana, , vol. 90, p. 1277 - 1289 |
|
~%
4-methoxy-2-nit... CAS#:18092-54-1 |
| Literature: Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), , vol. 28, p. 1851 - 1856 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, , vol. 28, # 9 p. 2005 - 2011 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Methoxy-2-nitrobenzenesulphonyl chloride |
| 4-Methoxy-2-nitrobenzenesulfonyl chloride |
| EINECS 241-996-9 |
| 4-Methoxy-2-nitrophenylsulfonylchlorid |
| 4-methoxy-2-nitrobenzene-1-sulfonyl chloride |
| 2-Nitro-4-methoxyphenylsulfonyl chloride |
| 4-methoxy-2-nitrobenzenesulfonylchloride |
| 2-Nitro-4-methoxy-benzolsulfonsaeure-chlorid |
| 4-Methoxy-2-nitrobenzolsulfonylchlorid |