1-Bromo-2-methyl-3,4-dinitrobenzene structure
|
Common Name | 1-Bromo-2-methyl-3,4-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 290353-57-0 | Molecular Weight | 261.030 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 364.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H5BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5±26.5 °C | |
| Name | 1-Bromo-2-methyl-3,4-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 364.8±37.0 °C at 760 mmHg |
| Molecular Formula | C7H5BrN2O4 |
| Molecular Weight | 261.030 |
| Flash Point | 174.5±26.5 °C |
| Exact Mass | 259.943268 |
| PSA | 91.64000 |
| LogP | 2.70 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | OXYXHHOXCIPFBY-UHFFFAOYSA-N |
| SMILES | Cc1c(Br)ccc([N+](=O)[O-])c1[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Bromo-2-methyl-3,4-dinitrobenzene |
| Benzene, 1-bromo-2-methyl-3,4-dinitro- |
| 1-bromo-2-methyl-3,4-dinitro-benzene |
| QC-782 |