dimethyl iodoterephthalate structure
|
Common Name | dimethyl iodoterephthalate | ||
|---|---|---|---|---|
| CAS Number | 1829-22-7 | Molecular Weight | 292.02700 | |
| Density | 2.138g/cm3 | Boiling Point | 438.5ºC at 760 mmHg | |
| Molecular Formula | C8H5IO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219ºC | |
| Name | 2-iodoterephthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.138g/cm3 |
|---|---|
| Boiling Point | 438.5ºC at 760 mmHg |
| Molecular Formula | C8H5IO4 |
| Molecular Weight | 292.02700 |
| Flash Point | 219ºC |
| Exact Mass | 291.92300 |
| PSA | 74.60000 |
| LogP | 1.68760 |
| Vapour Pressure | 1.82E-08mmHg at 25°C |
| Index of Refraction | 1.704 |
| InChIKey | LUZKKRPROWYBLR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(=O)O)c(I)c1 |
| HS Code | 2915900090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Jod-terephthalsaeure |
| dimethyl iodoterephthalate |
| iodoterephthalic acid |
| 2-iodo-1,4-benzenedicarboxylic acid |