Dimethyl aminoterephthalate structure
|
Common Name | Dimethyl aminoterephthalate | ||
|---|---|---|---|---|
| CAS Number | 5372-81-6 | Molecular Weight | 209.19900 | |
| Density | 1.248 g/cm3 | Boiling Point | 345.6ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | 132 °C | |
| MSDS | Chinese | Flash Point | 172.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Dimethyl aminoterephthalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248 g/cm3 |
|---|---|
| Boiling Point | 345.6ºC at 760 mmHg |
| Melting Point | 132 °C |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 172.6ºC |
| Exact Mass | 209.06900 |
| PSA | 78.62000 |
| LogP | 1.42320 |
| Index of Refraction | 1.558 |
| InChIKey | DSSKDXUDARIMTR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(N)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39-S36/37/39-S22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | CZ4340000 |
| HS Code | 29224995 |
| Precursor 7 | |
|---|---|
| DownStream 9 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|
Mahaffy CA.
Synth. React. Inorg. Met.-Org. Chem. 14(6) , 895-903, (1984)
|
| EINECS 236-307-3 |
| Dimethyl 3-aminoterephthalate |
| 2,5-Bis-carbomethoxyaniline |
| DIMETHYLNITROISOPHTHALATE-5 |
| 2-aminoterephthalic acid dimethyl ester |
| 2-AMINODIMETHYL TEREPHTHALATE |
| aminoterephthalic acid dimethyl ester |
| 5-NITRO DIMETHYL ISOPHTHALATE |
| Dimethyl-2-aminoterephthalat |
| DIMETHYL AMINOTEREOHTHALATE |
| MFCD00008429 |
| Dimethylaminoterephthalate |
| Dimethyl 2-aminoterephthalate |
| dimethyl 2-aminobenzene-1,4-dicarboxylate |
| dimethyl 2-amino-1,4-benzenedicarboxylate |
| 1-aminobenzene-2,5-dicarboxylic acid dimethyl ester |