Methyl (3-nitro-2-oxo-1(2H)-pyridinyl)acetate structure
|
Common Name | Methyl (3-nitro-2-oxo-1(2H)-pyridinyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 183666-09-3 | Molecular Weight | 212.160 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 387.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H8N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.2±27.9 °C | |
| Name | methyl 2-(3-nitro-2-oxopyridin-1-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 387.6±42.0 °C at 760 mmHg |
| Molecular Formula | C8H8N2O5 |
| Molecular Weight | 212.160 |
| Flash Point | 188.2±27.9 °C |
| Exact Mass | 212.043320 |
| PSA | 94.12000 |
| LogP | -0.45 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | ZMKHLIVBMSVMCP-UHFFFAOYSA-N |
| SMILES | COC(=O)Cn1cccc([N+](=O)[O-])c1=O |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
|
~%
Methyl (3-nitro... CAS#:183666-09-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 7, # 10 p. 1337 - 1342 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1(2H)-Pyridineacetic acid, 3-nitro-2-oxo-, methyl ester |
| SC2751 |
| Methyl (3-nitro-2-oxo-1(2H)-pyridinyl)acetate |
| Methyl (3-nitro-2-oxopyridin-1(2H)-yl)acetate |
| Methyl 2-(3-nitro-2-oxopyridin-1(2H)-yl)acetate |
| methyl 3-nitropyrid-2-one-1-acetate |