Methyl indolyl-3-glyoxylate structure
|
Common Name | Methyl indolyl-3-glyoxylate | ||
|---|---|---|---|---|
| CAS Number | 18372-22-0 | Molecular Weight | 203.194 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 383.2±15.0 °C at 760 mmHg | |
| Molecular Formula | C11H9NO3 | Melting Point | 227-230 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 185.6±20.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | methyl 2-(1H-indol-3-yl)-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 383.2±15.0 °C at 760 mmHg |
| Melting Point | 227-230 °C(lit.) |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.194 |
| Flash Point | 185.6±20.4 °C |
| Exact Mass | 203.058243 |
| PSA | 59.16000 |
| LogP | 1.19 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | VFIJGAWYVXDYLK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)c1c[nH]c2ccccc12 |
| Stability | Temperature Sensitive |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
|
Lasting chemiluminescence of 3-indoleglyoxylyl chloride and its enhancement.
Anal. Sci. 19(1) , 123-7, (2003) The chemiluminescence (CL) intensities of various indole derivatives substituted with a glyoxylyl group at the 3-position and a hydroxyl group at the 5-position of the indole ring were compared upon t... |
|
Name: Dicer-mediated maturation of pre-microRNA
Source: Center for Chemical Genomics, University of Michigan
Target: N/A
External Id: TargetID_659_CEMA
|
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| methyl indolyl-3-glyoxylate |
| (1H-indol-3-yl)oxoacetic acid methyl ester |
| Methyl 3-indoleglyoxylate |
| MFCD00047173 |
| 2-(3-Indolyl)-2-oxoessigsaeure-methylester |
| 3-indoleglyoxylic acid methyl ester |
| Indole-3-glyoxylic acid methyl ester |
| Methyl 2-(indol-3-yl)-2-oxoacetate |
| Methyl Indol-3-Glyoxylate |
| Methyl 1H-indol-3-yl(oxo)acetate |
| methyl indole-3-glyoxylate |