4-(4-Hydroxyphenoxy)-3,5-diiodobenzoic acid
Modify Date: 2025-11-03 00:11:44
4-(4-Hydroxyphenoxy)-3,5-diiodobenzoic acid structure
|
Common Name | 4-(4-Hydroxyphenoxy)-3,5-diiodobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1838-55-7 | Molecular Weight | 482.00900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8I2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-hydroxyphenoxy)-3,5-diiodobenzoic acid |
|---|
| Molecular Formula | C13H8I2O4 |
|---|---|
| Molecular Weight | 482.00900 |
| Exact Mass | 481.85100 |
| PSA | 66.76000 |
| LogP | 4.09190 |
| InChIKey | LPNQFIJWELQLRO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(I)c(Oc2ccc(O)cc2)c(I)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |