3,5-Diiodothyroacetic Acid structure
|
Common Name | 3,5-Diiodothyroacetic Acid | ||
|---|---|---|---|---|
| CAS Number | 1155-40-4 | Molecular Weight | 496.04 | |
| Density | 2.156g/cm3 | Boiling Point | 527.8ºC at 760mmHg | |
| Molecular Formula | C14H10I2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273ºC | |
Use of 3,5-Diiodothyroacetic Acid3,5-Diiodothyroacetic acid is a thyroid hormone analog. 3,5-Diiodothyroacetic acid lowers blood cholesterol concentrations. 3,5-Diiodothyroacetic acid can be used for hypothyroidism diseases research[1]. |
| Name | 3,5-diiodothyroacetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 3,5-Diiodothyroacetic acid is a thyroid hormone analog. 3,5-Diiodothyroacetic acid lowers blood cholesterol concentrations. 3,5-Diiodothyroacetic acid can be used for hypothyroidism diseases research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.156g/cm3 |
|---|---|
| Boiling Point | 527.8ºC at 760mmHg |
| Molecular Formula | C14H10I2O4 |
| Molecular Weight | 496.04 |
| Flash Point | 273ºC |
| Exact Mass | 495.86700 |
| PSA | 66.76000 |
| LogP | 4.02080 |
| Vapour Pressure | 5.7E-12mmHg at 25°C |
| Index of Refraction | 1.726 |
| InChIKey | KKJBNMLZBHFYAE-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cc(I)c(Oc2ccc(O)cc2)c(I)c1 |
| HS Code | 2918990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(4-Hydroxyphenoxy)-3,5-diiodobenzeneacetic acid |
| 2-(4-(4-hydroxyphenoxy)-3,5-diiodophenyl)acetic acid |
| 3,5-Diiodo Thyroacetic Acid |
| THYROACETIC ACID |
| [4-(4-Hydroxy-phenoxy)-3,5-dijod-phenyl]-essigsaeure |
| 2,6-Diiod-4-carboxymethyl-4'-hydroxy-diphenylether |
| EINECS 214-582-0 |
| 4-(4-HYDROXYPHENOXY)-3,5-DIIODOPHENYLACETIC ACID |
| [4-(p-Hydroxyphenoxy)-3,5-diiodophenyl]acetic Acid |