Methyl Tri-O-acetyl-1-naphthol Glucuronate structure
|
Common Name | Methyl Tri-O-acetyl-1-naphthol Glucuronate | ||
|---|---|---|---|---|
| CAS Number | 18404-55-2 | Molecular Weight | 478.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H26O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl (3S,4S,5S,6S)-3,4,5-triacetyloxy-6-naphthalen-1-yloxyoxane-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H26O11 |
|---|---|
| Molecular Weight | 478.44600 |
| Exact Mass | 478.14800 |
| PSA | 180.05000 |
| LogP | 0.76260 |
| Index of Refraction | 1.572 |
| InChIKey | XUZRMMOSHNKHPK-QEYOZYJFSA-N |
| SMILES | COC(=O)C1OC(Oc2cccc3ccccc23)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
|
~%
Methyl Tri-O-ac... CAS#:18404-55-2 |
| Literature: Bollenback et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 3310,3315 |
|
~%
Methyl Tri-O-ac... CAS#:18404-55-2 |
| Literature: Corner et al. Biochemical Journal, 1954 , vol. 56, p. 270,272 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Naphthyl--D-glucopyranosiduronic Acid Methyl Ester Triacetate |
| Methyl Tri-O-acetyl-1-naphthol Glucuronate |
| 1-Naphthol 2,3,4-Tri-O-acetyl--D-glucuronide Methyl Ester |