1H,1H,9H-Hexadecafluorononyl methacrylate
Modify Date: 2025-08-25 11:33:38
1H,1H,9H-Hexadecafluorononyl methacrylate structure
|
Common Name | 1H,1H,9H-Hexadecafluorononyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 1841-46-9 | Molecular Weight | 500.17600 | |
| Density | 1.618 g/mL at 25 °C(lit.) | Boiling Point | 234 °C(lit.) | |
| Molecular Formula | C13H8F16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | 1H,1H,9H-Hexadecafluorononyl methacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.618 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 234 °C(lit.) |
| Molecular Formula | C13H8F16O2 |
| Molecular Weight | 500.17600 |
| Flash Point | >230 °F |
| Exact Mass | 500.02700 |
| PSA | 26.30000 |
| LogP | 5.81790 |
| Vapour Pressure | 0.0173mmHg at 25°C |
| Index of Refraction | n20/D 1.344(lit.) |
| InChIKey | XAENZTGUQXVFPQ-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| Storage condition | Keep Cold |
| Hazard Codes | Xi: Irritant;F: Flammable; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2916140000 |
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| 1h,1h,9h-hexadecafluorononyl methacrylate |
| EINECS 217-419-1 |
| MFCD00078427 |