1H,1H,9H-Hexadecafluorononyl acrylate structure
|
Common Name | 1H,1H,9H-Hexadecafluorononyl acrylate | ||
|---|---|---|---|---|
| CAS Number | 4180-26-1 | Molecular Weight | 486.14900 | |
| Density | 1.646 | Boiling Point | 75°C 1mm | |
| Molecular Formula | C12H6F16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >110°C | |
| Name | 1H,1H,9H-Hexadecafluorononyl acrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.646 |
|---|---|
| Boiling Point | 75°C 1mm |
| Molecular Formula | C12H6F16O2 |
| Molecular Weight | 486.14900 |
| Flash Point | >110°C |
| Exact Mass | 486.01100 |
| PSA | 26.30000 |
| LogP | 5.42780 |
| Index of Refraction | 1.337 |
| InChIKey | QXDKTLFTMZTCKT-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| HS Code | 2916129000 |
|---|---|
| Summary | 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl prop-2-enoate |
| EINECS 224-053-6 |
| MFCD00078281 |