bis(triethoxysilyl)methane structure
|
Common Name | bis(triethoxysilyl)methane | ||
|---|---|---|---|---|
| CAS Number | 18418-72-9 | Molecular Weight | 340.56100 | |
| Density | 0.974 | Boiling Point | 114ºC | |
| Molecular Formula | C13H32O6Si2 | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 114ºC | |
| Name | triethoxy(triethoxysilylmethyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.974 |
|---|---|
| Boiling Point | 114ºC |
| Melting Point | <0ºC |
| Molecular Formula | C13H32O6Si2 |
| Molecular Weight | 340.56100 |
| Flash Point | 114ºC |
| Exact Mass | 340.17400 |
| PSA | 55.38000 |
| LogP | 2.62240 |
| Vapour Pressure | 0.024mmHg at 25°C |
| Index of Refraction | 1.4098 |
| InChIKey | NIINUVYELHEORX-UHFFFAOYSA-N |
| SMILES | CCO[Si](C[Si](OCC)(OCC)OCC)(OCC)OCC |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2931900090 |
|
~%
bis(triethoxysi... CAS#:18418-72-9 |
|
Literature: Kogyo Kagaku Zasshi, , vol. 59, p. 1359,1362 Chem.Abstr., , p. 15423 J.Inst.Polytech.Osaka City Univ. |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| bis-(triethoxy)disilamethane |
| Bis-triaethoxysilyl-methan |
| bis(triethoxysilyl)methylene |
| BIS(TRIETHOXYSILYL)METHANE |
| bis-triethoxysilanyl-methane |