8-methyl-1H-pyrimido[5,4-c]cinnoline-2,4-dithione structure
|
Common Name | 8-methyl-1H-pyrimido[5,4-c]cinnoline-2,4-dithione | ||
|---|---|---|---|---|
| CAS Number | 184230-24-8 | Molecular Weight | 260.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8N4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-methyl-1H-pyrimido[5,4-c]cinnoline-2,4-dithione |
|---|
| Molecular Formula | C11H8N4S2 |
|---|---|
| Molecular Weight | 260.33800 |
| Exact Mass | 260.01900 |
| PSA | 129.16000 |
| LogP | 2.45880 |
| InChIKey | AOMOACMEXROHHA-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)nnc1c(=S)[nH]c(=S)[nH]c12 |
|
~%
8-methyl-1H-pyr... CAS#:184230-24-8 |
| Literature: Menon, R. Gopikumar; Purushothaman Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 1996 , vol. 35, # 11 p. 1185 - 1189 |