4-chloro-(n-boc)aniline 97 structure
|
Common Name | 4-chloro-(n-boc)aniline 97 | ||
|---|---|---|---|---|
| CAS Number | 18437-66-6 | Molecular Weight | 227.68700 | |
| Density | 1.195g/cm3 | Boiling Point | 265.2ºC at 760 mmHg | |
| Molecular Formula | C11H14ClNO2 | Melting Point | 102-106ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 114.2ºC | |
| Name | tert-butyl N-(4-chlorophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.195g/cm3 |
|---|---|
| Boiling Point | 265.2ºC at 760 mmHg |
| Melting Point | 102-106ºC(lit.) |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.68700 |
| Flash Point | 114.2ºC |
| Exact Mass | 227.07100 |
| PSA | 38.33000 |
| LogP | 3.76000 |
| Appearance of Characters | Crystalline Powder | White |
| Vapour Pressure | 0.00929mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | VFEHOBXXLPHSOI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cl)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Bioorthogonal imaging of aurora kinase A in live cells.
Angew. Chem. Int. Ed. Engl. 51(27) , 6598-603, (2012)
|
| MFCD00816772 |
| N-Boc-4-chloro-aniline |
| 4-chloro-NHBoc-aniline |
| N-BOC-4-Chloroaniline |
| N-tert-Butoxycarbonyl-4-chloroaniline |
| N-t-butyloxycarbonyl-4-chloroaniline |