tert-Butyl-4-methoxycarbanilate structure
|
Common Name | tert-Butyl-4-methoxycarbanilate | ||
|---|---|---|---|---|
| CAS Number | 18437-68-8 | Molecular Weight | 223.268 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 278.5±23.0 °C at 760 mmHg | |
| Molecular Formula | C12H17NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 122.3±22.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tert-butyl N-(4-methoxyphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 278.5±23.0 °C at 760 mmHg |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.268 |
| Flash Point | 122.3±22.6 °C |
| Exact Mass | 223.120850 |
| PSA | 47.56000 |
| LogP | 2.61 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | DTJDZTUATTYLBB-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)OC(C)(C)C)cc1 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| t-Butyl (4-methoxy-phenyl)-carbamate |
| BOC-p-anisidine |
| 2-Methyl-2-propanyl (4-methoxyphenyl)carbamate |
| (4-methoxyphenyl)carbamic acid tert-butyl ester |
| N-Boc-p-methoxyaniline |
| tert-butyl 4-methoxyphenylcarbamate |
| tert-Butyl-4-methoxycarbanilate |
| tert-butyl N-(4-methoxyphenyl)carbamate |
| N-Boc-p-anisidine |
| 4-methoxy-N-(tert-butoxycarbonyl)aniline |
| N-Boc-4-methoxyaniline |
| Carbamic acid, N-(4-methoxyphenyl)-, 1,1-dimethylethyl ester |
| tert-butyl (4-methoxyphenyl)carbamate |