1-O-ethyl 3-O-trimethylsilyl propanedioate structure
|
Common Name | 1-O-ethyl 3-O-trimethylsilyl propanedioate | ||
|---|---|---|---|---|
| CAS Number | 18457-03-9 | Molecular Weight | 204.29600 | |
| Density | 1.004g/cm3 | Boiling Point | 262.4ºC at 760mmHg | |
| Molecular Formula | C8H16O4Si | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 62.9ºC | |
| Symbol |
GHS02 |
Signal Word | Warning | |
| Name | 1-O-ethyl 3-O-trimethylsilyl propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.004g/cm3 |
|---|---|
| Boiling Point | 262.4ºC at 760mmHg |
| Molecular Formula | C8H16O4Si |
| Molecular Weight | 204.29600 |
| Flash Point | 62.9ºC |
| Exact Mass | 204.08200 |
| PSA | 52.60000 |
| LogP | 1.31770 |
| Vapour Pressure | 0.0109mmHg at 25°C |
| Index of Refraction | n20/D 1.416(lit.) |
| InChIKey | PVXMKQLVICGFSI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)O[Si](C)(C)C |
| Symbol |
GHS02 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Risk Phrases | 10 |
| Safety Phrases | 23-24/25 |
| RIDADR | UN 3272 3/PG 3 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| EINECS 242-340-4 |
| Ethyl trimethylsilyl malonate |
| MFCD00042885 |