3H-Indazol-3-one,1,2-dihydro-2-(phenylmethyl)- structure
|
Common Name | 3H-Indazol-3-one,1,2-dihydro-2-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 1848-46-0 | Molecular Weight | 224.25800 | |
| Density | 1.242g/cm3 | Boiling Point | 390ºC at 760mmHg | |
| Molecular Formula | C14H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.6ºC | |
| Name | 2-benzyl-1H-indazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 390ºC at 760mmHg |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.25800 |
| Flash Point | 189.6ºC |
| Exact Mass | 224.09500 |
| PSA | 37.79000 |
| LogP | 2.37790 |
| Vapour Pressure | 2.74E-06mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | IBMDKBAGSDBZIJ-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2[nH]n1Cc1ccccc1 |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Benzyl-indazolon |
| 2-benzyl-1,2-dihydro-3H-indazol-3-one |
| 2-benzylindazolone |
| 2-benzyl-1,2-dihydro-indazol-3-one |
| 2-Benzyl-1,2-dihydro-indazol-3-on |