3H-Indazol-3-one,1,2-dihydro-1-phenyl- structure
|
Common Name | 3H-Indazol-3-one,1,2-dihydro-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 28561-80-0 | Molecular Weight | 210.23100 | |
| Density | 1.264g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenyl-2H-indazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.23100 |
| Exact Mass | 210.07900 |
| PSA | 37.79000 |
| LogP | 2.31880 |
| Index of Refraction | 1.65 |
| InChIKey | MTYIBGCJCVRBMH-UHFFFAOYSA-N |
| SMILES | O=c1[nH]n(-c2ccccc2)c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-phenylindazol-3-ol |
| 1-phenyl-1H-indazol-3-ol |
| 1-Phenyl-1,2-dihydro-indazol-3-on |
| 1-Phenyl-1,2-dihydro-3H-indazol-3-one |
| 1H-Indazol-3-ol,1-phenyl |
| 1-phenyl-1,2-dihydro-indazol-3-one |