Allyl(triphenyl)phosphonium chloride structure
|
Common Name | Allyl(triphenyl)phosphonium chloride | ||
|---|---|---|---|---|
| CAS Number | 18480-23-4 | Molecular Weight | 338.810 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H20ClP | Melting Point | 227-229 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triphenyl(prop-2-enyl)phosphanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 227-229 °C |
|---|---|
| Molecular Formula | C21H20ClP |
| Molecular Weight | 338.810 |
| Exact Mass | 338.099121 |
| PSA | 13.59000 |
| LogP | 1.17050 |
| InChIKey | FKMJROWWQOJRJX-UHFFFAOYSA-M |
| SMILES | C=CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~%
Allyl(triphenyl... CAS#:18480-23-4 |
| Literature: Journal of Organic Chemistry, , vol. 28, p. 372 - 379 |
|
~%
Allyl(triphenyl... CAS#:18480-23-4 |
| Literature: Liebigs Annalen der Chemie, , # 2 p. 291 - 304 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Allyltriphenylphosphoniumchlorid |
| EINECS 242-368-7 |
| MFCD00031542 |
| ALLYL-TRIPHENYL-PHOSPHONIUM,CHLORIDE |
| Phosphonium, triphenyl-2-propen-1-yl-, chloride (1:1) |
| Allyltriphenylphosphonium Chloride |
| Allyl triphenylphosphonium chloride |
| Allyl(triphenyl)phosphonium chloride |
| Allyl-triphenyl-phosphonium |