N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide
![N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide Structure](https://image.chemsrc.com/caspic/420/185244-08-0.png)
N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide structure
|
Common Name | N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 185244-08-0 | Molecular Weight | 303.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H17NO3S |
|---|---|
| Molecular Weight | 303.37600 |
| Exact Mass | 303.09300 |
| PSA | 75.11000 |
| LogP | 4.52470 |
| InChIKey | IKMVOCASLGGGHO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~88%
N-[(4-methylphe... CAS#:185244-08-0 |
| Literature: Sisko, Joseph; Mellinger, Mark; Sheldrake, Peter W.; Baine, Neil H. Tetrahedron Letters, 1996 , vol. 37, # 45 p. 8113 - 8116 |
|
~%
N-[(4-methylphe... CAS#:185244-08-0 |
| Literature: Murry; Frantz; Soheili; Tillyer; Grabowski; Reider Journal of the American Chemical Society, 2001 , vol. 123, # 39 p. 9696 - 9697 |
|
~35%
N-[(4-methylphe... CAS#:185244-08-0 |
| Literature: Beguin, Cecile; Andurkar, Shridhar V.; Jin, Albert Y.; Stables, James P.; Weaver, Donald F.; Kohn, Harold Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 19 p. 4275 - 4285 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide? |
| A: Molecular formula of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide is C16H17NO3S. |
| Q: What is the CAS number of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide? |
| A: CAS number of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide is 185244-08-0. |
| Q: What is the LogP of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide? |
| A: LogP of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide is 4.52470. |
| Q: What is the Chinese name of 185244-08-0? |
| A: Chinese name of 185244-08-0 is 185244-08-0. |
| Q: What is the molecular weight of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide? |
| A: Molecular weight of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide is 303.37600. |
| Q: What is the polar surface area (PSA) of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide? |
| A: Polar surface area (PSA) of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide is 75.11000. |
| Q: What is the InChIKey of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide? |
| A: InChIKey of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide is IKMVOCASLGGGHO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide? |
| A: SMILES notation of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide is CC(=O)NC(c1ccccc1)S(=O)(=O)c1ccc(C)cc1. |
| Q: What is the English name of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide? |
| A: The English name of N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide is N-[(4-methylphenyl)sulfonyl-phenylmethyl]acetamide. |