4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene
4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene structure
|
Common Name | 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene | ||
|---|---|---|---|---|
| CAS Number | 185244-58-0 | Molecular Weight | 283.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15BrO2 |
|---|---|
| Molecular Weight | 283.16100 |
| Exact Mass | 282.02600 |
| PSA | 18.46000 |
| LogP | 3.94520 |
| InChIKey | XFRREDIDDZMIRZ-UHFFFAOYSA-N |
| SMILES | C=C1CCCC1Oc1cc(Br)ccc1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-bromo-1-metho... CAS#:185244-58-0 |
| Literature: Van der Mey; Hatzelmann; Van Klink; Van der Laan; Sterk; Thibaut; Ulrich; Timmerman Journal of Medicinal Chemistry, 2001 , vol. 44, # 16 p. 2523 - 2535 |
|
~%
4-bromo-1-metho... CAS#:185244-58-0 |
| Literature: Van der Mey; Hatzelmann; Van Klink; Van der Laan; Sterk; Thibaut; Ulrich; Timmerman Journal of Medicinal Chemistry, 2001 , vol. 44, # 16 p. 2523 - 2535 |
|
~%
4-bromo-1-metho... CAS#:185244-58-0 |
| Literature: Van der Mey; Hatzelmann; Van Klink; Van der Laan; Sterk; Thibaut; Ulrich; Timmerman Journal of Medicinal Chemistry, 2001 , vol. 44, # 16 p. 2523 - 2535 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene? |
| A: LogP of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene is 3.94520. |
| Q: What is the molecular weight of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene? |
| A: Molecular weight of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene is 283.16100. |
| Q: What is the English name of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene? |
| A: The English name of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene is 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene. |
| Q: What is the polar surface area (PSA) of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene? |
| A: Polar surface area (PSA) of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene is 18.46000. |
| Q: What is the InChIKey of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene? |
| A: InChIKey of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene is XFRREDIDDZMIRZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 185244-58-0? |
| A: Chinese name of 185244-58-0 is 185244-58-0. |
| Q: What is the CAS number of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene? |
| A: CAS number of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene is 185244-58-0. |
| Q: What is the molecular formula of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene? |
| A: Molecular formula of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene is C13H15BrO2. |
| Q: What is the SMILES notation of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene? |
| A: SMILES notation of 4-bromo-1-methoxy-2-(2-methylidenecyclopentyl)oxybenzene is C=C1CCCC1Oc1cc(Br)ccc1OC. |