1-(2-methoxy-2-oxoethyl)pyridinium chloride structure
|
Common Name | 1-(2-methoxy-2-oxoethyl)pyridinium chloride | ||
|---|---|---|---|---|
| CAS Number | 18667-21-5 | Molecular Weight | 187.62300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-pyridin-1-ium-1-ylacetate,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H10ClNO2 |
|---|---|
| Molecular Weight | 187.62300 |
| Exact Mass | 187.04000 |
| PSA | 30.18000 |
| InChIKey | NARUMFSATWTJPE-UHFFFAOYSA-M |
| SMILES | COC(=O)C[n+]1ccccc1.[Cl-] |
| HS Code | 2933399090 |
|---|
|
~90%
1-(2-methoxy-2-... CAS#:18667-21-5 |
| Literature: Kaupp, Gerd; Hunkler, Dieter; Zimmermann, Inge Chemische Berichte, 1982 , vol. 115, # 7 p. 2467 - 2477 |
|
~78%
1-(2-methoxy-2-... CAS#:18667-21-5 |
| Literature: Tsuge, Otohiko; Kanemasa, Shuji; Takenaka, Shigeori Bulletin of the Chemical Society of Japan, 1986 , vol. 59, # 11 p. 3631 - 3636 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(Methoxycarbonylmethyl)pyridinium-chlorid |
| Pyridinium,1-(2-methoxy-2-oxoethyl)-,chloride |
| N-methoxycarbonylmethylpyridinium chloride |
| 1-(2-Methoxy-2-oxoethyl)pyridinium chloride |
| EINECS 242-489-5 |
| Pyridinium,1-(2-methoxy-2-oxoethyl)-,chloride (9CI) |
| 1-(methoxycarbonylmethyl)pyridinium chloride |
| Pyridinium,1-(2-methoxy-2-oxoethyl)-,chloride (1:1) |
| Pyridinium,1-(carboxymethyl)-,chloride,methyl ester (8CI) |