2,3,5,6-tetrafluoro-4-hydrazinobenzotrifluoride structure
|
Common Name | 2,3,5,6-tetrafluoro-4-hydrazinobenzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 1868-85-5 | Molecular Weight | 248.10100 | |
| Density | 1.694 g/cm3 | Boiling Point | 142.9ºC at 760 mmHg | |
| Molecular Formula | C7H3F7N2 | Melting Point | 81-83 °C(lit.) | |
| MSDS | N/A | Flash Point | 40.2ºC | |
| Name | [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.694 g/cm3 |
|---|---|
| Boiling Point | 142.9ºC at 760 mmHg |
| Melting Point | 81-83 °C(lit.) |
| Molecular Formula | C7H3F7N2 |
| Molecular Weight | 248.10100 |
| Flash Point | 40.2ºC |
| Exact Mass | 248.01800 |
| PSA | 38.05000 |
| LogP | 3.32070 |
| InChIKey | TVSDZBUZBHRNBV-UHFFFAOYSA-N |
| SMILES | NNc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| Storage condition | 2-8°C |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2928000090 |
|
~%
2,3,5,6-tetrafl... CAS#:1868-85-5 |
| Literature: Journal of the Chemical Society, , p. 1801 - 1805 |
|
~%
2,3,5,6-tetrafl... CAS#:1868-85-5 |
| Literature: Journal of the Chemical Society, , p. 1801 - 1805 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,3,5,6-Tetrafluoro-4-hydrazinobenzotrifluoride |
| 4-hydrazoheptafluorotoluene |
| (Perfluoro-p-tolyl)hydrazine |
| (α,α,α,2,3,5,6-Heptafluoro-p-tolyl)hydrazine |
| MFCD00012368 |
| 2,3,4,5-TETRAFLUORO-D-PHENYLALANINE |
| (alpha,alpha,alpha,2,3,5,6-Heptafluoro-p-tolyl)hydrazine |