1,1,1,3,5,5,5-Heptamethyltrisiloxane structure
|
Common Name | 1,1,1,3,5,5,5-Heptamethyltrisiloxane | ||
|---|---|---|---|---|
| CAS Number | 1873-88-7 | Molecular Weight | 222.505 | |
| Density | 0.819 g/mL at 25 °C(lit.) | Boiling Point | 163.8±23.0 °C at 760 mmHg | |
| Molecular Formula | C7H22O2Si3 | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 52.8±22.6 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | methyl-bis(trimethylsilyloxy)silicon |
|---|---|
| Synonym | More Synonyms |
| Density | 0.819 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 163.8±23.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C7H22O2Si3 |
| Molecular Weight | 222.505 |
| Flash Point | 52.8±22.6 °C |
| Exact Mass | 222.092758 |
| PSA | 18.46000 |
| LogP | 5.32 |
| Vapour Pressure | 2.7±0.3 mmHg at 25°C |
| Index of Refraction | n20/D 1.382(lit.) |
| InChIKey | SWGZAKPJNWCPRY-UHFFFAOYSA-N |
| SMILES | C[Si](O[Si](C)(C)C)O[Si](C)(C)C |
| Stability | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H315-H319-H335 |
| Precautionary Statements | P210-P305 + P351 + P338-P370 + P378-P403 + P235 |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R10;R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Precursor 7 | |
|---|---|
| DownStream 9 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (TMSO)2MeSi |
| EINECS 217-496-1 |
| HSi(OSiMe3)2Me |
| Trisiloxane,1,1,1,3,5,5,5-heptamethyl |
| Bis(trimethylsiloxy)methylsilane |
| Methylpolysilicone |
| HSi(OTMS)2Me |
| Methylbis(trimethylsilyloxy)silane |
| Trisiloxane, 1,1,1,3,5,5,5-heptamethyl- |
| MFCD00048000 |
| (Me3SiO)2MeSiH |
| 1,1,1,3,5,5,5-Heptamethyltrisiloxane |
| HSi(OSMe3)2Me |