21-deoxycortisone structure
|
Common Name | 21-deoxycortisone | ||
|---|---|---|---|---|
| CAS Number | 1882-82-2 | Molecular Weight | 344.44500 | |
| Density | 1.21g/cm3 | Boiling Point | 524.6ºC at 760mmHg | |
| Molecular Formula | C21H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.1ºC | |
| Name | 21-Deoxy Cortisone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 524.6ºC at 760mmHg |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.44500 |
| Flash Point | 285.1ºC |
| Exact Mass | 344.19900 |
| PSA | 71.44000 |
| LogP | 3.01740 |
| Vapour Pressure | 3.39E-13mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | PUKLDDOGISCFCP-JSQCKWNTSA-N |
| SMILES | CC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(=O)CC21C |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| EINECS 217-541-5 |
| (8S,9S,10R,13S,14S,17R)-17-acetyl-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione |
| MFCD00051123 |