JTP 103237
Modify Date: 2025-08-31 17:54:53
JTP 103237 structure
|
Common Name | JTP 103237 | ||
|---|---|---|---|---|
| CAS Number | 1883864-16-1 | Molecular Weight | 474.522 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 571.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C24H29F3N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.3±32.9 °C | |
Use of JTP 103237JTP 103237 is a potent and selective monoacyglycerol acyltransferase 2 (MOGAT2) inhibitor. |
| Name | 7-[4,6-Bis(2-methyl-2-propanyl)-2-pyrimidinyl]-3-[4-(trifluoromethoxy)phenyl]-5,6,7,8-tetrahydro[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 571.3±60.0 °C at 760 mmHg |
| Molecular Formula | C24H29F3N6O |
| Molecular Weight | 474.522 |
| Flash Point | 299.3±32.9 °C |
| Exact Mass | 474.235504 |
| LogP | 6.69 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | KELNXHBJTXCXSN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)nc(N2CCn3c(nnc3-c3ccc(OC(F)(F)F)cc3)C2)n1 |
| 7-[4,6-Bis(2-methyl-2-propanyl)-2-pyrimidinyl]-3-[4-(trifluoromethoxy)phenyl]-5,6,7,8-tetrahydro[1,2,4]triazolo[4,3-a]pyrazine |
| 1,2,4-Triazolo[4,3-a]pyrazine, 7-[4,6-bis(1,1-dimethylethyl)-2-pyrimidinyl]-5,6,7,8-tetrahydro-3-[4-(trifluoromethoxy)phenyl]- |