JTP-117968
Modify Date: 2025-08-27 11:23:44
JTP-117968 structure
|
Common Name | JTP-117968 | ||
|---|---|---|---|---|
| CAS Number | 2250132-99-9 | Molecular Weight | 520.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H31F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of JTP-117968JTP-117968, a novel selective glucocorticoid receptor modulator (a non-steroidal SGRM, IC50 of 6.8 nM), exhibits improved transrepression/transactivation dissociation[1]. |
| Name | JTP-117968 |
|---|
| Description | JTP-117968, a novel selective glucocorticoid receptor modulator (a non-steroidal SGRM, IC50 of 6.8 nM), exhibits improved transrepression/transactivation dissociation[1]. |
|---|---|
| Related Catalog | |
| In Vitro | JTP-117968 has partial TR activity, but exhibits extremely low TA activity[1]. |
| References |
| Molecular Formula | C31H31F3N2O2 |
|---|---|
| Molecular Weight | 520.59 |
| InChIKey | VOOOFTVRKCSOIU-NPBSGPTKSA-N |
| SMILES | Cc1ncccc1NC(=O)c1ccc2c(c1)CC1(CC1)C1CC(O)(C(F)(F)F)CCC21Cc1ccccc1 |