o-tolunitrile, 6-nitro- structure
|
Common Name | o-tolunitrile, 6-nitro- | ||
|---|---|---|---|---|
| CAS Number | 1885-76-3 | Molecular Weight | 162.145 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 326.2±30.0 °C at 760 mmHg | |
| Molecular Formula | C8H6N2O2 | Melting Point | 108-110ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 151.1±24.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-methyl-6-nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 326.2±30.0 °C at 760 mmHg |
| Melting Point | 108-110ºC(lit.) |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.145 |
| Flash Point | 151.1±24.6 °C |
| Exact Mass | 162.042923 |
| PSA | 69.61000 |
| LogP | 1.79 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | BOTPDHNZLRJZOO-UHFFFAOYSA-N |
| SMILES | Cc1cccc([N+](=O)[O-])c1C#N |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2926909090 |
|
~74%
o-tolunitrile, ... CAS#:1885-76-3 |
| Literature: TEIJIN LIMITED Patent: US2005/267148 A1, 2005 ; |
|
~85%
o-tolunitrile, ... CAS#:1885-76-3 |
| Literature: Littke, Adam; Soumeillant, Maxime; Kaltenbach III, Robert F.; Cherney, Robert J.; Tarby, Christine M.; Kiau, Susanne Organic Letters, 2007 , vol. 9, # 9 p. 1711 - 1714 |
|
~%
o-tolunitrile, ... CAS#:1885-76-3 |
| Literature: US6469176 B1, ; |
|
~%
o-tolunitrile, ... CAS#:1885-76-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 6, # 6 p. 643 - 659 |
|
~%
o-tolunitrile, ... CAS#:1885-76-3 |
| Literature: Helvetica Chimica Acta, , vol. 43, p. 104 - 113 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis of 5-substituted quinazolines as potential antimalarial agents.
J. Med. Chem. 16(11) , 1233-7, (1973)
|
|
|
A microwave-assisted alternative synthesis of 8-amino-2-methyl-3, 4-dihydroisoquinolin-1-one. Glossop, SC.
Synthesis 2007(07) , 981-83, (2007)
|
| Benzonitrile, 2-methyl-6-nitro- |
| o-tolunitrile, 6-nitro- |
| 2-methyl-6-nitro-benzonitrile |
| o-Tolunitrile,6-nitro |
| 6-nitro-2-toluonitrile |
| WNR C1 BCN |
| 6-nitro-o-toluonitrile |
| 2-cyano-3-nitrotoluene |
| 2-Methyl-6-nitro-benzonitril |
| EINECS 217-553-0 |
| 2-Methyl-6-nitrobenzonitrile |
| 6-Nitro-o-tolunitrile |
| MFCD00007266 |