N-(4-chlorophenyl)-2-phenoxy-acetamide structure
|
Common Name | N-(4-chlorophenyl)-2-phenoxy-acetamide | ||
|---|---|---|---|---|
| CAS Number | 18861-18-2 | Molecular Weight | 261.70400 | |
| Density | 1.29g/cm3 | Boiling Point | 468.5ºC at 760 mmHg | |
| Molecular Formula | C14H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.2ºC | |
| Name | N-(4-chlorophenyl)-2-phenoxyacetamide |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 468.5ºC at 760 mmHg |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.70400 |
| Flash Point | 237.2ºC |
| Exact Mass | 261.05600 |
| PSA | 38.33000 |
| LogP | 3.43050 |
| Vapour Pressure | 5.94E-09mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | LKWTYSBLFSQIBX-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccccc1)Nc1ccc(Cl)cc1 |
|
~%
N-(4-chlorophen... CAS#:18861-18-2 |
| Literature: Baker,B.R.; Hurlbut,J.A. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 1129 - 1133 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |