N-(3-chlorophenyl)-2-phenoxy-acetamide structure
|
Common Name | N-(3-chlorophenyl)-2-phenoxy-acetamide | ||
|---|---|---|---|---|
| CAS Number | 18861-20-6 | Molecular Weight | 261.70400 | |
| Density | 1.29g/cm3 | Boiling Point | 465.4ºC at 760 mmHg | |
| Molecular Formula | C14H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.3ºC | |
| Name | N-(3-chlorophenyl)-2-phenoxyacetamide |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 465.4ºC at 760 mmHg |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.70400 |
| Flash Point | 235.3ºC |
| Exact Mass | 261.05600 |
| PSA | 38.33000 |
| LogP | 3.43050 |
| Vapour Pressure | 7.69E-09mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | CZHNETVVDYJJCX-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccccc1)Nc1cccc(Cl)c1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(3-chlorophen... CAS#:18861-20-6 |
| Literature: Baker,B.R.; Hurlbut,J.A. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 1129 - 1133 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |