trans-4,4'-Dibromostilbene structure
|
Common Name | trans-4,4'-Dibromostilbene | ||
|---|---|---|---|---|
| CAS Number | 18869-30-2 | Molecular Weight | 338.037 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 392.9±11.0 °C at 760 mmHg | |
| Molecular Formula | C14H10Br2 | Melting Point | 212ºC | |
| MSDS | USA | Flash Point | 223.9±18.5 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 4,4'-dibromo-trans-stilbene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 392.9±11.0 °C at 760 mmHg |
| Melting Point | 212ºC |
| Molecular Formula | C14H10Br2 |
| Molecular Weight | 338.037 |
| Flash Point | 223.9±18.5 °C |
| Exact Mass | 335.914917 |
| LogP | 6.61 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.698 |
| InChIKey | JEHMPNUQSJNJDL-OWOJBTEDSA-N |
| SMILES | Brc1ccc(C=Cc2ccc(Br)cc2)cc1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H413 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn;N |
| Risk Phrases | R22;R38;R41;R51 |
| Safety Phrases | S53-S26-S39-S61 |
| RIDADR | UN 3077 |
| HS Code | 2903999090 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,1,1'-(1E)-1,2-ethenediylbis[4-broMo |
| (E)-1,2-bis(p-phenylbromo)ethene |
| 4,4'-dibromo-(E)-1,2-diphenylethene |
| (E)-1,2-bis(p-bromophenyl)ethene |
| 1-BROMO-4-[2-(4-BROMOPHENYL)VINYL]BENZENE |
| (E)-1,2-Bis(4-bromophenyl)ethene |
| (E)-1,2-bis(4-bromophenyl)ethane |
| 1,2-Bis(4-bromophenyl)ethene |
| 4,4'-Dibromostilbene |
| 1,1'-(E)-Ethene-1,2-diylbis(4-bromobenzene) |
| trans-4,4'-Dibromostilbene |
| (E)-1-bromo-4-(4-bromostyryl)benzene |
| 1,1'-[(E)-1,2-Ethenediyl]bis(4-bromobenzene) |
| 4,4'-DIBROMO-STILBENE |
| 4,4'-Dibromo-trans-stilbene |
| Benzene, 1,1'-[(E)-1,2-ethenediyl]bis[4-bromo- |