Diethyl 4-Bromobenzylphosphonate structure
|
Common Name | Diethyl 4-Bromobenzylphosphonate | ||
|---|---|---|---|---|
| CAS Number | 38186-51-5 | Molecular Weight | 307.12100 | |
| Density | 1.366 g/cm3 | Boiling Point | 376.023ºC at 760 mmHg | |
| Molecular Formula | C11H16BrO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-bromo-4-(diethoxyphosphorylmethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366 g/cm3 |
|---|---|
| Boiling Point | 376.023ºC at 760 mmHg |
| Molecular Formula | C11H16BrO3P |
| Molecular Weight | 307.12100 |
| Exact Mass | 306.00200 |
| PSA | 45.34000 |
| LogP | 4.21520 |
| Index of Refraction | 1.515 |
| InChIKey | IPTXXSZUISGKCJ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(Cc1ccc(Br)cc1)OCC |
| HS Code | 2931900090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Diethyl (4-BroMobenzyl)phosphonate |
| (4-Bromobenzyl)phosphonic Acid Diethyl Ester |
| D3688 |
| 4-bromo-1-diethylphosphonomethyl-benzene |
| diethyl [(4-bromophenyl)methyl]phosphonate |
| diethyl 4-bromobenzylphosphonate |
| (4-bromobenzyl)diethyl phosphonate |