Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl]
Modify Date: 2025-09-10 12:14:29
![Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl] Structure](https://www.chemsrc.com/extcaspic/198/1889970-49-3.png)
Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl] structure
|
Common Name | Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl] | ||
|---|---|---|---|---|
| CAS Number | 1889970-49-3 | Molecular Weight | 240.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H20N2OS |
|---|---|
| Molecular Weight | 240.37 |
| InChIKey | MIOQRWUUZTWRDD-UHFFFAOYSA-N |
| SMILES | Cc1nc(CC(C)C)sc1C1CNCCO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl]? |
| A: Molecular formula of Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl] is C12H20N2OS. |
| Q: What is the CAS number of Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl]? |
| A: CAS number of Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl] is 1889970-49-3. |
| Q: What is the Chinese name of 1889970-49-3? |
| A: Chinese name of 1889970-49-3 is 1889970-49-3. |
| Q: What is the SMILES notation of Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl]? |
| A: SMILES notation of Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl] is Cc1nc(CC(C)C)sc1C1CNCCO1. |
| Q: What is the molecular weight of Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl]? |
| A: Molecular weight of Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl] is 240.37. |
| Q: What is the InChIKey of Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl]? |
| A: InChIKey of Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl] is MIOQRWUUZTWRDD-UHFFFAOYSA-N. |
| Q: What is the English name of Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl]? |
| A: The English name of Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl] is Morpholine, 2-[4-methyl-2-(2-methylpropyl)-5-thiazolyl]. |