8-methyl-9-thia-3,4,7-triazabicyclo[4.3.0]nona-7,10-diene-2,5-dione structure
|
Common Name | 8-methyl-9-thia-3,4,7-triazabicyclo[4.3.0]nona-7,10-diene-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 7464-12-2 | Molecular Weight | 183.18800 | |
| Density | 1.522g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H5N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-5,6-dihydro-[1,3]thiazolo[4,5-d]pyridazine-4,7-dione |
|---|
| Density | 1.522g/cm3 |
|---|---|
| Molecular Formula | C6H5N3O2S |
| Molecular Weight | 183.18800 |
| Exact Mass | 183.01000 |
| PSA | 106.85000 |
| Index of Refraction | 1.616 |
| InChIKey | AFUIGSKTJVHHHJ-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(=O)[nH][nH]c(=O)c2s1 |
|
~%
8-methyl-9-thia... CAS#:7464-12-2 |
| Literature: Childress; McKee Journal of the American Chemical Society, 1951 , vol. 73, p. 3862 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |