10H-Phenothiazine-10-carbonyl chloride structure
|
Common Name | 10H-Phenothiazine-10-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 18956-87-1 | Molecular Weight | 261.727 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 416.1±28.0 °C at 760 mmHg | |
| Molecular Formula | C13H8ClNOS | Melting Point | 168-172 °C | |
| MSDS | N/A | Flash Point | 205.4±24.0 °C | |
| Name | Phenothiazine-10-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 416.1±28.0 °C at 760 mmHg |
| Melting Point | 168-172 °C |
| Molecular Formula | C13H8ClNOS |
| Molecular Weight | 261.727 |
| Flash Point | 205.4±24.0 °C |
| Exact Mass | 261.001526 |
| PSA | 45.61000 |
| LogP | 3.87 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | MJRIZSDRKPPHTK-UHFFFAOYSA-N |
| SMILES | O=C(Cl)N1c2ccccc2Sc2ccccc21 |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S45-S36/37/39-S28A-S26-S24/25 |
| HS Code | 2934300000 |
|
~%
10H-Phenothiazi... CAS#:18956-87-1 |
| Literature: Chemische Berichte, , vol. 18, p. 1844 Chemische Berichte, , vol. 24, p. 2908 |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10-chlorocarbonyl-phenothiazine |
| 10H-Phenothiazine-10-carbonyl chloride |
| phenothioazine-10-carbonyl chloride |
| phenothiazine-10-carboxyl chloride |
| N-chloroformylphenothiazine |
| EINECS 242-699-7 |
| Phenothiazine-10-carbonyl chloride |
| N-chlorocarbonylphenothiazine |
| MFCD00044216 |
| BB_SC-5369 |