5,6-Difluoroisobenzofuran-1,3-dione structure
|
Common Name | 5,6-Difluoroisobenzofuran-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 18959-30-3 | Molecular Weight | 184.096 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 321.2±32.0 °C at 760 mmHg | |
| Molecular Formula | C8H2F2O3 | Melting Point | 99-100℃ | |
| MSDS | N/A | Flash Point | 143.3±20.0 °C | |
| Name | 5,6-difluoro-2-benzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 321.2±32.0 °C at 760 mmHg |
| Melting Point | 99-100℃ |
| Molecular Formula | C8H2F2O3 |
| Molecular Weight | 184.096 |
| Flash Point | 143.3±20.0 °C |
| Exact Mass | 183.997192 |
| PSA | 43.37000 |
| LogP | 1.61 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | UATBWQQFLABWKR-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2cc(F)c(F)cc21 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2932999099 |
|
~%
5,6-Difluoroiso... CAS#:18959-30-3 |
| Literature: Synthetic Communications, , vol. 22, # 21 p. 3067 - 3074 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5-Difluorophthalic anhydride |
| 4,5-Difluor-phthalsaeureanhydrid |
| 5,6-Difluoro-2-benzofuran-1,3-dione |
| 1,3-isobenzofurandione,5,6-difluoro |
| 4,5-DIFLUORO PHTHALIC ANHYDRIDE |
| 4,5-difluoro-phthalic acid anhydride |
| 1,3-Isobenzofurandione, 5,6-difluoro- |
| 5,6-Difluoroisobenzofuran-1,3-dione |
| MFCD00152992 |