4,5-dichlorophthalic anhydride structure
|
Common Name | 4,5-dichlorophthalic anhydride | ||
|---|---|---|---|---|
| CAS Number | 942-06-3 | Molecular Weight | 217.006 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 313.0±22.0 °C at 760 mmHg | |
| Molecular Formula | C8H2Cl2O3 | Melting Point | 185-187 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 144.8±21.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,5-dichlorophthalic anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 313.0±22.0 °C at 760 mmHg |
| Melting Point | 185-187 °C(lit.) |
| Molecular Formula | C8H2Cl2O3 |
| Molecular Weight | 217.006 |
| Flash Point | 144.8±21.3 °C |
| Exact Mass | 215.938095 |
| PSA | 43.37000 |
| LogP | 2.66 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | ULSOWUBMELTORB-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2cc(Cl)c(Cl)cc21 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
|
~95%
4,5-dichloropht... CAS#:942-06-3 |
| Literature: Caswell; Guevara; Corley; Martinez; Hollis; Largess; Thornley Synthesis, 1992 , # 9 p. 823 - 825 |
|
~%
4,5-dichloropht... CAS#:942-06-3 |
| Literature: Zhurnal Prikladnoi Khimii (Sankt-Peterburg, Russian Federation), , vol. 7, p. 1113 Chem. Zentralbl., , vol. 107, # II p. 2901 |
|
~%
4,5-dichloropht... CAS#:942-06-3
Detail
|
| Literature: Journal of Organic Chemistry, , vol. 48, # 15 p. 2465 - 2468 |
|
~%
Detail
|
| Literature: Chemische Berichte, , vol. 42, p. 3533 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5-Dichlor-phthalsaeure-anhydrid |
| 5,6-DICHLORO-1,3-DIHYDROISOBENZOFURAN-1,3-DIONE |
| 5,6-dichloro-1,3-isobenzofurandione |
| MFCD00075034 |
| 5,6-Dichloro-2-benzofuran-1,3-dione |
| EINECS 213-386-2 |
| 5,6-dichlorophthalic anhydride |
| 4,5-dichloro-phthalic acid anhydride |
| 1,3-Isobenzofurandione, 5,6-dichloro- |
| 5,6-dichloroisobenzofuran-1,3-dione |
| 4,5-Dichlorophalic anhydride |