2,3,5,6-Tetrachloroterephthalonitrile structure
|
Common Name | 2,3,5,6-Tetrachloroterephthalonitrile | ||
|---|---|---|---|---|
| CAS Number | 1897-41-2 | Molecular Weight | 265.911 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 370.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C8Cl4N2 | Melting Point | 308-312 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 166.8±22.1 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 2,3,5,6-tetrachlorobenzene-1,4-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 370.1±42.0 °C at 760 mmHg |
| Melting Point | 308-312 °C(lit.) |
| Molecular Formula | C8Cl4N2 |
| Molecular Weight | 265.911 |
| Flash Point | 166.8±22.1 °C |
| Exact Mass | 263.881561 |
| PSA | 47.58000 |
| LogP | 3.24 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | TXRVDQMSXQKAPG-UHFFFAOYSA-N |
| SMILES | N#Cc1c(Cl)c(Cl)c(C#N)c(Cl)c1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H410 |
| Precautionary Statements | P273-P280-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
| Risk Phrases | R43 |
| Safety Phrases | S24-S37-S61-S60 |
| RIDADR | 3077 |
| WGK Germany | 1 |
| RTECS | TI8275000 |
| HS Code | 2926909090 |
|
~89%
2,3,5,6-Tetrach... CAS#:1897-41-2 |
| Literature: Journal of Fluorine Chemistry, , vol. 125, # 3 p. 451 - 454 |
|
~%
2,3,5,6-Tetrach... CAS#:1897-41-2 |
| Literature: US4517129 A1, ; |
|
~%
2,3,5,6-Tetrach... CAS#:1897-41-2 |
| Literature: Journal of Fluorine Chemistry, , vol. 125, # 3 p. 451 - 454 |
|
~%
2,3,5,6-Tetrach... CAS#:1897-41-2 |
| Literature: Journal of Fluorine Chemistry, , vol. 125, # 3 p. 451 - 454 |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Antiinflammatory activity in Long Evans rat assessed as reduction of carrageenan-indu...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3253010
|
|
Name: Toxicity in mouse assessed as overt effects
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL3257605
|
| p-Tetrachlorophthalodinitrile |
| 1,4-dicyano-2,3,5,6-tetrachlorobenzene |
| Tetrachloroterephthalonitrile |
| p-TCPN |
| tetrachloroterephthalic nitrile |
| 1,4-(CN)2-C6Cl4 |
| Perchloroterephthalonitrile |
| tetrachloro-p-dicyanobenzene |
| 1,4-Benzenedicarbonitrile,2,3,5,6-tetrachloro |
| 2,3,5,6-tetrachloroterephthalodinitrile |
| EINECS 401-550-8 |
| MFCD00059583 |
| p-Phthalodinitrile,tetrachloro |
| 2,3,5,6-Tetrachloroterephthalonitrile |
| 2,3,5,6-tetrachloro-1,4-benzenedicarbonitrile |