2,3,5,6-tetrafluoroterephthalaldehyde structure
|
Common Name | 2,3,5,6-tetrafluoroterephthalaldehyde | ||
|---|---|---|---|---|
| CAS Number | 3217-47-8 | Molecular Weight | 206.09400 | |
| Density | 1.59g/cm3 | Boiling Point | 252.566ºC at 760 mmHg | |
| Molecular Formula | C8H2F4O2 | Melting Point | 130-132 ºC | |
| MSDS | N/A | Flash Point | 96.169ºC | |
| Name | 2,3,5,6-tetrafluoroterephthalaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 252.566ºC at 760 mmHg |
| Melting Point | 130-132 ºC |
| Molecular Formula | C8H2F4O2 |
| Molecular Weight | 206.09400 |
| Flash Point | 96.169ºC |
| Exact Mass | 205.99900 |
| PSA | 34.14000 |
| LogP | 1.86800 |
| Index of Refraction | 1.525 |
| InChIKey | WJHRAPYKYJKACM-UHFFFAOYSA-N |
| SMILES | O=Cc1c(F)c(F)c(C=O)c(F)c1F |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2913000090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 2,3,5,6-Tetrafluorotelephtal aldehyde |
| 2,3,5,6-tetrafluoroterephthaldehyde |
| 2,3,5,6-tetrafluorobenzene-1,4-dicarbaldehyde |
| 2,3,5,6-tetrafluorotelephthalaldehyde |
| AC-775 |
| tetrafluoroterephthaldehyde |