4,4'-Diisopropylbiphenyl structure
|
Common Name | 4,4'-Diisopropylbiphenyl | ||
|---|---|---|---|---|
| CAS Number | 18970-30-4 | Molecular Weight | 238.367 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 330.6±22.0 °C at 760 mmHg | |
| Molecular Formula | C18H22 | Melting Point | 66°C | |
| MSDS | N/A | Flash Point | 161.7±13.1 °C | |
| Name | 1-propan-2-yl-4-(4-propan-2-ylphenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 330.6±22.0 °C at 760 mmHg |
| Melting Point | 66°C |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.367 |
| Flash Point | 161.7±13.1 °C |
| Exact Mass | 238.172150 |
| LogP | 6.65 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | NUEUMFZLNOCRCQ-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(-c2ccc(C(C)C)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36:Irritating to the eyes. |
| Safety Phrases | S26-S36/37 |
| WGK Germany | 3 |
| HS Code | 2902909090 |
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| 4,4'-diisopropanylbiphenyl |
| 4,4'-di(propan-2-yl)biphenyl |
| 4,4'-bis(1-methylethyl)biphenyl |
| 1,1'-Biphenyl, 4,4'-bis-(1-methylethyl) |
| 4,4'-Diisopropylbiphenyl |
| 4,4'-Di-iso-propylbiphenyl |
| 4,4'-DIISOPROPYLBIPHENYLE |
| 1,1'-Biphenyl, ar,ar'-bis(1-methylethyl)- |
| 4,4'-Diisopropyl-1,1'-biphenyl |
| 4,4′-Diisopropylbiphenyl |
| 1,1'-Biphenyl, 4,4'-bis(1-methylethyl)- |
| MFCD00043533 |
| 4,4'-bis(isopropyl)biphenyl |